| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:09 UTC |
|---|
| Update Date | 2025-03-25 00:47:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02162796 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H16N2O9S |
|---|
| Molecular Mass | 364.0577 |
|---|
| SMILES | O=C(NC1C(O)OC(COS(=O)(=O)O)C(O)C1O)c1ccccn1 |
|---|
| InChI Key | UPQARSIOTDEMGV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | acylaminosugars |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diols2-halopyridines2-heteroaryl carboxamidesalkyl sulfatesazacyclic compoundscarboxylic acids and derivativeshemiacetalsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespyridinecarboxylic acids and derivativessecondary alcoholssecondary carboxylic acid amidessulfuric acid monoesters |
|---|
| Substituents | pyridine carboxylic acid or derivativessulfuric acid monoesteraromatic heteromonocyclic compoundmonosaccharidecarboxylic acid derivative2-heteroaryl carboxamiden-acyl-alpha-hexosamineorganic oxidealkyl sulfateorganonitrogen compoundorganopnictogen compoundhemiacetal2-halopyridineoxaneorganoheterocyclic compound1,2-diolalcoholorganic sulfuric acid or derivativesazacycleheteroaromatic compoundhydroxypyridinecarboxamide groupacylaminosugaroxacyclesecondary carboxylic acid amidepyridinesecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid ester |
|---|