Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:43:09 UTC |
---|
Update Date | 2025-03-25 00:47:36 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02162796 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C12H16N2O9S |
---|
Molecular Mass | 364.0577 |
---|
SMILES | O=C(NC1C(O)OC(COS(=O)(=O)O)C(O)C1O)c1ccccn1 |
---|
InChI Key | UPQARSIOTDEMGV-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | acylaminosugars |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | 1,2-diols2-halopyridines2-heteroaryl carboxamidesalkyl sulfatesazacyclic compoundscarboxylic acids and derivativeshemiacetalsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespyridinecarboxylic acids and derivativessecondary alcoholssecondary carboxylic acid amidessulfuric acid monoesters |
---|
Substituents | pyridine carboxylic acid or derivativessulfuric acid monoesteraromatic heteromonocyclic compoundmonosaccharidecarboxylic acid derivative2-heteroaryl carboxamiden-acyl-alpha-hexosamineorganic oxidealkyl sulfateorganonitrogen compoundorganopnictogen compoundhemiacetal2-halopyridineoxaneorganoheterocyclic compound1,2-diolalcoholorganic sulfuric acid or derivativesazacycleheteroaromatic compoundhydroxypyridinecarboxamide groupacylaminosugaroxacyclesecondary carboxylic acid amidepyridinesecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid ester |
---|