| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:10 UTC |
|---|
| Update Date | 2025-03-25 00:47:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02162808 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H16N2O7 |
|---|
| Molecular Mass | 288.0958 |
|---|
| SMILES | O=C(Cc1c[nH]cn1)OC1C(O)OC(CO)C(O)C1O |
|---|
| InChI Key | UWEQJAFJIUECKG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acid estershemiacetalsheteroaromatic compoundshydrocarbon derivativesimidazolesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | carbonyl grouparomatic heteromonocyclic compoundmonosaccharidecarboxylic acid derivativeorganic oxideimidazoleorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundazolealcoholazacycleheteroaromatic compoundoxacyclemonocarboxylic acid or derivativescarboxylic acid estersecondary alcoholhydrocarbon derivativeorganic nitrogen compound |
|---|
