| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:11 UTC |
|---|
| Update Date | 2025-03-25 00:47:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02162867 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H20O11 |
|---|
| Molecular Mass | 448.1006 |
|---|
| SMILES | O=C(C=Cc1ccccc1O)c1c(O)cc(O)cc1OC1OC(C(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | NAUSLLFWZCQDSE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavonoid glycosides |
|---|
| Direct Parent | flavonoid o-glycosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsalpha,beta-unsaturated ketonesaryl ketonesbenzoyl derivativesbeta hydroxy acids and derivativescarboxylic acidscinnamylphenolsglucuronic acid derivativeshydrocarbon derivativeshydroxycinnamic acidsmonocarboxylic acids and derivativesmonosaccharideso-glucuronidesorganic oxidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundspyran carboxylic acidsresorcinolssecondary alcoholsvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupcarboxylic acidglucuronic acid or derivativesaromatic heteromonocyclic compoundbenzoylo-glucuronide1-hydroxy-2-unsubstituted benzenoidmonosaccharidecinnamylphenolalpha,beta-unsaturated ketonecarboxylic acid derivativepyran carboxylic acidhydroxycinnamic acid or derivativesresorcinolketone1-o-glucuronidecinnamic acid or derivativesbeta-hydroxy acidsaccharideorganic oxideacetaloxaneorganoheterocyclic compoundalcohollinear 1,3-diarylpropanoidpyran carboxylic acid or derivativeshydroxy acid1-hydroxy-4-unsubstituted benzenoidflavonoid o-glycosidehydroxycinnamic acidoxacyclevinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundpyransecondary alcoholphenolhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compoundaryl ketone |
|---|