| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:12 UTC |
|---|
| Update Date | 2025-03-25 00:47:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02162879 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O6 |
|---|
| Molecular Mass | 300.0634 |
|---|
| SMILES | O=C(C=Cc1ccc(O)cc1)C(=O)c1c(O)cc(O)cc1O |
|---|
| InChI Key | TYYPTTPXPHXIST-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | hydroxycinnamic acids and derivatives |
|---|
| Direct Parent | hydroxycinnamic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacryloyl compoundsacylphloroglucinols and derivativesalpha-diketonesaryl ketonesbenzoyl derivativesenoneshydrocarbon derivativesorganic oxidesvinylogous acids |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupbenzoyl1-hydroxy-2-unsubstituted benzenoidalpha,beta-unsaturated ketoneketonephloroglucinol derivativeorganic oxideenoneacylphloroglucinol derivativebenzenetriol1-hydroxy-4-unsubstituted benzenoidalpha-diketonehydroxycinnamic acidaromatic homomonocyclic compoundvinylogous acidorganic oxygen compoundphenolhydrocarbon derivativebenzenoidacryloyl-grouporganooxygen compoundaryl ketone |
|---|
