| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:13 UTC |
|---|
| Update Date | 2025-03-25 00:47:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02162930 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H25ClN2O3S |
|---|
| Molecular Mass | 456.1274 |
|---|
| SMILES | O=C(C1CCS(=O)(=O)C1)N1CCC(=C2c3ccc(Cl)cc3CCc3cccnc32)CC1 |
|---|
| InChI Key | DGLOIBBVDSAWBC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzocycloheptapyridines |
|---|
| Subclass | benzocycloheptapyridines |
|---|
| Direct Parent | benzocycloheptapyridines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesaryl chloridesazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesn-acylpiperidinesorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compoundspolyhalopyridinespyridines and derivativessulfonestertiary carboxylic acid amidesthiolanes |
|---|
| Substituents | thiolanecarbonyl grouppolyhalopyridineorganochloridecarboxylic acid derivativeorganohalogen compoundorganic oxidearomatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compound2-halopyridinepiperidinearyl chlorideazacycleheteroaromatic compoundcarboxamide grouparyl haliden-acyl-piperidinepyridineorganic oxygen compoundbenzocycloheptapyridinehydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundsulfone |
|---|