| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:13 UTC |
|---|
| Update Date | 2025-03-25 00:47:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02162944 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H11NO5 |
|---|
| Molecular Mass | 297.0637 |
|---|
| SMILES | O=C(C(=O)c1c[nH]c2ccccc12)c1c(O)cc(O)cc1O |
|---|
| InChI Key | OKHYLUIJCISUCA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | phenylacetylindoles |
|---|
| Direct Parent | phenylacetylindoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacylphloroglucinols and derivativesalpha-diketonesaryl ketonesazacyclic compoundsbenzoyl derivativesheteroaromatic compoundshydrocarbon derivativesindolesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrrolesvinylogous acidsvinylogous amides |
|---|
| Substituents | monocyclic benzene moietyindolebenzoyl1-hydroxy-2-unsubstituted benzenoidketonephloroglucinol derivativeorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundacylphloroglucinol derivativevinylogous amideazacyclebenzenetriolheteroaromatic compound1-hydroxy-4-unsubstituted benzenoidalpha-diketonevinylogous acidorganic oxygen compoundpyrrolephenolhydrocarbon derivativebenzenoidorganic nitrogen compoundphenylacetylindoleorganooxygen compoundaryl ketone |
|---|
