| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:14 UTC |
|---|
| Update Date | 2025-03-25 00:47:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02162972 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H16O8 |
|---|
| Molecular Mass | 372.0845 |
|---|
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)OC(O)C(=O)C=Cc1ccc(O)c(O)c1 |
|---|
| InChI Key | OECOOKJNOUKJCH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | hydroxycinnamic acids and derivatives |
|---|
| Direct Parent | hydroxycinnamic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacryloyl compoundsalpha-acyloxy ketonesalpha-hydroxy ketonesbenzene and substituted derivativesenoate estersenonesfatty acid estershemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxides |
|---|
| Substituents | fatty acylmonocyclic benzene moietycarbonyl groupalpha-acyloxy ketone1-hydroxy-2-unsubstituted benzenoidalpha,beta-unsaturated ketonealpha-hydroxy ketonecarboxylic acid derivativeketonealpha,beta-unsaturated carboxylic esterorganic oxidehemiacetalenoneenoate ester1-hydroxy-4-unsubstituted benzenoidhydroxycinnamic acidaromatic homomonocyclic compoundfatty acid estermonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterphenolhydrocarbon derivativebenzenoidacryloyl-grouporganooxygen compound |
|---|
