| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:14 UTC |
|---|
| Update Date | 2025-03-25 00:47:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02162988 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H16ClNOS2 |
|---|
| Molecular Mass | 301.0362 |
|---|
| SMILES | O=C(CCCC1CCSS1)Nc1ccc(Cl)cc1 |
|---|
| InChI Key | IZAZKCNAJHQCEO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | anilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-dithiolanesaryl chloridescarbonyl compoundscarboxylic acids and derivativeschlorobenzenesfatty amideshydrocarbon derivativesn-arylamidesorganic disulfidesorganic oxidesorganochloridesorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylcarbonyl grouparomatic heteromonocyclic compoundorganochloridefatty amiden-arylamidecarboxylic acid derivativeorganohalogen compound1,2-dithiolaneorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundaryl chloridechlorobenzenecarboxamide grouparyl halideanilidesecondary carboxylic acid amideorganic oxygen compounddithiolaneorganic disulfidehydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
