| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:16 UTC |
|---|
| Update Date | 2025-03-25 00:47:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02163063 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H20O10 |
|---|
| Molecular Mass | 384.1056 |
|---|
| SMILES | O=C(CCC(=O)c1ccc(O)cc1O)OC1CC(O)(C(=O)O)CC(O)C1O |
|---|
| InChI Key | ZFRPWPVQLNVIQV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | quinic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl-phenylketonesalpha hydroxy acids and derivativesaryl alkyl ketonesbenzoyl derivativesbutyrophenonescarboxylic acid esterscarboxylic acidscyclohexanolsdicarboxylic acids and derivativesfatty acid estersgamma-keto acids and derivativeshydrocarbon derivativesorganic oxidesresorcinolstertiary alcoholsvinylogous acids |
|---|
| Substituents | fatty acylmonocyclic benzene moietycarbonyl groupcarboxylic acidaryl alkyl ketonealpha-hydroxy acidbenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeresorcinolketoneorganic oxidecyclohexanolhydroxy acid1-hydroxy-4-unsubstituted benzenoidphenylketonegamma-keto acidbutyrophenonearomatic homomonocyclic compoundfatty acid estervinylogous acidtertiary alcoholketo acidcarboxylic acid estersecondary alcoholdicarboxylic acid or derivativesphenolhydrocarbon derivativebenzenoidalkyl-phenylketonearyl ketonequinic acid |
|---|
