| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:17 UTC |
|---|
| Update Date | 2025-03-25 00:47:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02163101 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9ClO3 |
|---|
| Molecular Mass | 212.024 |
|---|
| SMILES | O=C(O)C1(O)CCc2cc(Cl)ccc21 |
|---|
| InChI Key | KNFJMVKAEQQNPO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | indanes |
|---|
| Subclass | indanes |
|---|
| Direct Parent | indanes |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesaryl chloridescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochloridestertiary alcohols |
|---|
| Substituents | aryl chloridealcoholcarbonyl groupcarboxylic acidorganochloridealpha-hydroxy acidaromatic homopolycyclic compoundhydroxy acidcarboxylic acid derivativeorganohalogen compoundaryl halidetertiary alcoholorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundindanehydrocarbon derivativeorganooxygen compound |
|---|
