| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:18 UTC |
|---|
| Update Date | 2025-03-25 00:47:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02163133 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H8F2O6 |
|---|
| Molecular Mass | 214.0289 |
|---|
| SMILES | O=C(O)C1(O)OCC(O)C(O)C1(F)F |
|---|
| InChI Key | CJXCDURZJMCYPQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyran carboxylic acids and derivatives |
|---|
| Direct Parent | pyran carboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalkyl fluoridesalpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidsfluorohydrinshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganofluoridesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidalpha-hydroxy acidmonosaccharidefluorohydrincarboxylic acid derivativeorganohalogen compoundsaccharideorganic oxidealiphatic heteromonocyclic compoundhemiacetalalkyl halideoxane1,2-diolalcoholpyran carboxylic acid or derivativeshalohydrinalkyl fluorideorganofluoridehydroxy acidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
