| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:19 UTC |
|---|
| Update Date | 2025-03-25 00:47:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02163160 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H16O8S |
|---|
| Molecular Mass | 284.0566 |
|---|
| SMILES | O=C(O)C(O)CSC1C(O)OC(CO)C(O)C1O |
|---|
| InChI Key | MKYPYXOQBFAOOQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdialkylthioethershemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssulfenyl compounds |
|---|
| Substituents | carbonyl groupcarboxylic acidalpha-hydroxy acidmonosaccharideorganosulfur compoundcarboxylic acid derivativeorganic oxidealiphatic heteromonocyclic compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundalcoholsulfenyl compounddialkylthioetherhydroxy acidoxacyclemonocarboxylic acid or derivativesthioethersecondary alcoholhydrocarbon derivative |
|---|
