| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:20 UTC |
|---|
| Update Date | 2025-03-25 00:47:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02163196 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H2Cl4O3 |
|---|
| Molecular Mass | 261.8758 |
|---|
| SMILES | O=C(O)C1(O)C(Cl)=C(Cl)C(Cl)=C1Cl |
|---|
| InChI Key | FOMAGZMWCJQFBN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | alpha hydroxy acids and derivatives |
|---|
| Direct Parent | alpha hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidschloroalkeneschlorohydrinshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochloridestertiary alcoholsvinyl chlorides |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidchlorohydrinhalohydrinchloroalkeneorganochloridealpha-hydroxy acidcarboxylic acid derivativeorganohalogen compoundtertiary alcoholorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundvinyl halidehaloalkenealiphatic homomonocyclic compoundhydrocarbon derivativevinyl chlorideorganooxygen compound |
|---|
