| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:20 UTC |
|---|
| Update Date | 2025-03-25 00:47:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02163209 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H4Cl6O2 |
|---|
| Molecular Mass | 341.8342 |
|---|
| SMILES | O=C(O)C1C2(Cl)C(Cl)=C(Cl)C1(Cl)C(Cl)C2Cl |
|---|
| InChI Key | LTFVBDDQCKCNAQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | carboxylic acids |
|---|
| Direct Parent | carboxylic acids |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | alkyl chloridescarbonyl compoundschloroalkeneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochloridesvinyl chlorides |
|---|
| Substituents | carbonyl groupcarboxylic acidalkyl chloridechloroalkeneorganochlorideorganohalogen compoundaliphatic homopolycyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundvinyl halidehaloalkenealkyl halidehydrocarbon derivativevinyl chlorideorganooxygen compound |
|---|
