| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:21 UTC |
|---|
| Update Date | 2025-03-25 00:47:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02163228 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H20O7 |
|---|
| Molecular Mass | 372.1209 |
|---|
| SMILES | O=C(O)C1C(O)C(O)C(O)C(O)C1Oc1ccc2c(c1)-c1ccccc1C2 |
|---|
| InChI Key | NWSYGFCGJBDIIE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | fluorenes |
|---|
| Subclass | fluorenes |
|---|
| Direct Parent | fluorenes |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclitols and derivativescyclohexanolshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenol ethers |
|---|
| Substituents | alcoholfluorenephenol ethercarbonyl groupethercarboxylic acidcyclohexanolcyclitol or derivativesaromatic homopolycyclic compoundhydroxy acidcyclic alcoholalkyl aryl ethercarboxylic acid derivativebeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
