| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:24 UTC |
|---|
| Update Date | 2025-03-25 00:47:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02163356 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H26N2O5 |
|---|
| Molecular Mass | 338.1842 |
|---|
| SMILES | O=C(O)C(Cc1ccc(O)cc1)N1CCN(CCOCCO)CC1 |
|---|
| InChI Key | CUHUSAIMSMGECD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | tyrosine and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalcohols and polyolsalpha amino acidsamino acidsamphetamines and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acidsdialkyl ethershydrocarbon derivativesmonocarboxylic acids and derivativesn-alkylpiperazinesorganic oxidesorganopnictogen compoundsphenylalanine and derivativesphenylpropanoic acidstrialkylamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupethercarboxylic acidaromatic heteromonocyclic compound3-phenylpropanoic-acidamino acid1-hydroxy-2-unsubstituted benzenoiddialkyl etherorganic oxidepiperazinealpha-amino acidorganonitrogen compoundorganopnictogen compoundtertiary amineorganoheterocyclic compoundamphetamine or derivativesalcoholtyrosine or derivativesazacyclen-alkylpiperazinetertiary aliphatic aminemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compound1,4-diazinanephenolhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|