| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:25 UTC |
|---|
| Update Date | 2025-03-25 00:47:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02163378 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H9O10P |
|---|
| Molecular Mass | 259.9933 |
|---|
| SMILES | O=C(O)C(=O)C(O)(O)C(O)COP(=O)(O)O |
|---|
| InChI Key | QZPBJSFMANVKTP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acyloinsalpha-hydroxy ketonesalpha-keto acids and derivativesbeta-hydroxy ketonescarbonyl hydratescarboxylic acidshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidessecondary alcoholsshort-chain keto acids and derivatives |
|---|
| Substituents | beta-hydroxy ketonealiphatic acyclic compoundcarbonyl groupcarboxylic acidcarbonyl hydratepentose phosphateshort-chain keto acidalpha-hydroxy ketonecarboxylic acid derivativeketoneorganic oxidealpha-keto acidalcoholmonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphateketo acidacyloinsecondary alcoholhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|
