| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:25 UTC |
|---|
| Update Date | 2025-03-25 00:47:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02163389 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H8Cl3NO |
|---|
| Molecular Mass | 298.9671 |
|---|
| SMILES | O=C(Nc1ccc(Cl)cc1)c1ccc(Cl)cc1Cl |
|---|
| InChI Key | YKYNQSLLCKORDX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | benzanilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 2-halobenzoic acids and derivatives4-halobenzoic acids and derivativesaryl chloridesbenzamidesbenzoyl derivativescarboxylic acids and derivativesdichlorobenzeneshydrocarbon derivativesorganic oxidesorganochloridesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundssecondary carboxylic acid amidesvinylogous halides |
|---|
| Substituents | benzanilideorganochloridebenzoylcarboxylic acid derivativeorganohalogen compoundbenzamide1,3-dichlorobenzeneorganic oxideorganonitrogen compoundorganopnictogen compoundaryl chloridechlorobenzenebenzoic acid or derivativeshalobenzoic acid or derivativescarboxamide groupvinylogous halide2-halobenzoic acid or derivativesaryl halide4-halobenzoic acid or derivativesaromatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
