| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:26 UTC |
|---|
| Update Date | 2025-03-25 00:47:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02163410 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9O8P |
|---|
| Molecular Mass | 288.0035 |
|---|
| SMILES | O=C(O)C(=O)CC(=O)c1ccc(OP(=O)(O)O)cc1 |
|---|
| InChI Key | SXQZDDWHFVKVGP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha-hydroxy ketonesalpha-keto acids and derivativesaryl alkyl ketonesbenzoyl derivativesbutyrophenonescarboxylic acidsgamma-keto acids and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundsphenyl phosphates |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidaryl alkyl ketonebenzoylalpha-hydroxy ketonecarboxylic acid derivativeorganic oxidealpha-keto acidphenyl phosphategamma-keto acidbutyrophenonearomatic homomonocyclic compoundmonocarboxylic acid or derivativesphosphoric acid esterketo acidhydrocarbon derivativearyl phosphomonoesterbenzenoidphenoxy compoundaryl phosphateorganic phosphoric acid derivativealkyl-phenylketone |
|---|