| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:32 UTC |
|---|
| Update Date | 2025-03-25 00:47:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02163653 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H32O5 |
|---|
| Molecular Mass | 352.225 |
|---|
| SMILES | CC12CC(O)C3C(CCC4CC(O)(C(=O)O)CCC43C)C1CCC2O |
|---|
| InChI Key | ARMBOFGCVLSXKI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | androstane steroids |
|---|
| Direct Parent | androgens and derivatives |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | 11-hydroxysteroids17-hydroxysteroids3-hydroxysteroidsalpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclic alcohols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxosteroidssecondary alcoholstertiary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidandrogen-skeletonalpha-hydroxy acidcarboxylic acid derivativealiphatic homopolycyclic compoundorganic oxide17-hydroxysteroidalcoholoxosteroid3-hydroxysteroidhydroxysteroid18-oxosteroidhydroxy acidcyclic alcoholtertiary alcoholmonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivative11-hydroxysteroidorganooxygen compound |
|---|
