| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:34 UTC |
|---|
| Update Date | 2025-03-25 00:47:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02163736 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H16O5 |
|---|
| Molecular Mass | 336.0998 |
|---|
| SMILES | CC1(C)C=Cc2c(c(O)cc3occ(-c4ccc(O)cc4)c(=O)c23)O1 |
|---|
| InChI Key | IMZQGRZPLBAEAU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | pyranoisoflavonoids |
|---|
| Direct Parent | pyranoisoflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids2,2-dimethyl-1-benzopyransalkyl aryl ethersbenzene and substituted derivativeschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonesorganic oxidesoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | monocyclic benzene moietyether1-benzopyran2,2-dimethyl-1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundisoflavonebenzopyranheteroaromatic compoundpyranoisoflavonoidoxacycleorganic oxygen compoundpyranphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|