| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:34 UTC |
|---|
| Update Date | 2025-03-25 00:47:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02163743 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H13NO3 |
|---|
| Molecular Mass | 207.0895 |
|---|
| SMILES | CC1(C)CC(=O)c2cc(O)c(O)cc2N1 |
|---|
| InChI Key | DPRYFNRGKAKHNE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | quinolones and derivatives |
|---|
| Direct Parent | hydroquinolones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaryl alkyl ketonesazacyclic compoundsbenzenoidshydrocarbon derivativeshydroquinolinesorganic oxidesorganooxygen compoundsorganopnictogen compoundssecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | vinylogous amidetetrahydroquinolonearyl alkyl ketoneazacycle1-hydroxy-2-unsubstituted benzenoidsecondary aminesecondary aliphatic/aromatic amineketoneorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundtetrahydroquinolineamineorganooxygen compoundaryl ketone |
|---|
