| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:35 UTC |
|---|
| Update Date | 2025-03-25 00:47:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02163751 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H19ClO |
|---|
| Molecular Mass | 202.1124 |
|---|
| SMILES | CC1(C)CC2(Cl)C(O)CC1C2(C)C |
|---|
| InChI Key | CBOSOKXEUUCXMW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | monoterpenoids |
|---|
| Direct Parent | bicyclic monoterpenoids |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | alkyl chlorideschlorohydrinscyclic alcohols and derivativeshydrocarbon derivativesorganochloridessecondary alcohols |
|---|
| Substituents | alcoholchlorohydrinhalohydrinalkyl chlorideorganochloridecyclic alcoholorganohalogen compoundaliphatic homopolycyclic compoundorganic oxygen compoundsecondary alcoholalkyl halidehydrocarbon derivativebicyclic monoterpenoidorganooxygen compound |
|---|