| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:35 UTC |
|---|
| Update Date | 2025-03-25 00:47:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02163765 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14O6 |
|---|
| Molecular Mass | 230.079 |
|---|
| SMILES | CC1(CC(=O)O)CC(=O)CC(C)(C(=O)O)O1 |
|---|
| InChI Key | LGTBYZXKCSIRSI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyran carboxylic acids and derivatives |
|---|
| Direct Parent | pyran carboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carboxylic acidscyclic ketonesdialkyl ethersdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesoxacyclic compoundsoxanes |
|---|
| Substituents | carbonyl groupethercarboxylic acidpyran carboxylic acid or derivativescyclic ketonecarboxylic acid derivativedialkyl etherketoneoxacycleorganic oxideorganic oxygen compoundaliphatic heteromonocyclic compounddicarboxylic acid or derivativeshydrocarbon derivativeoxaneorganooxygen compound |
|---|