| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:35 UTC |
|---|
| Update Date | 2025-03-25 00:47:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02163768 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H36O2 |
|---|
| Molecular Mass | 344.2715 |
|---|
| SMILES | CC1(C=O)CCC2(C)C3=C(CCC12)C1(C)CCC(O)C(C)(C)C1CC3 |
|---|
| InChI Key | STVQOKPOWXROSG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | oxosteroids |
|---|
| Direct Parent | 20-oxosteroids |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | 3-hydroxysteroidsaldehydescyclic alcohols and derivativeshydrocarbon derivativesorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholcarbonyl group3-hydroxysteroidaldehydehydroxysteroidcyclic alcohol20-oxosteroidaliphatic homopolycyclic compoundorganic oxideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
