| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:37 UTC |
|---|
| Update Date | 2025-03-25 00:47:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02163851 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H21N3O10S |
|---|
| Molecular Mass | 435.0948 |
|---|
| SMILES | CC1(C)OC2C3OC(n4ccc(=O)[nH]c4=O)C(O)C3COC2(COS(N)(=O)=O)O1 |
|---|
| InChI Key | IHMJTIKRKMIMNU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | dioxolopyrans |
|---|
| Subclass | dioxolopyrans |
|---|
| Direct Parent | dioxolopyrans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,3-dioxolanesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesketalslactamsmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganic sulfuric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespyrimidonessecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | meta-dioxolanelactammonosaccharidepyrimidonepyrimidinesaccharideorganic oxideacetalaromatic heteropolycyclic compoundketalorganonitrogen compoundorganopnictogen compoundoxanedioxolopyranalcoholvinylogous amidecarbonic acid derivativeorganic sulfuric acid or derivativesazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
