| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:41 UTC |
|---|
| Update Date | 2025-03-25 00:47:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02163985 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C37H46N4O8 |
|---|
| Molecular Mass | 674.3316 |
|---|
| SMILES | CC1=C2Cc3[nH]c(c(C)c3CCC(=O)O)Cc3[nH]c(c(CCC(=O)O)c3C)Cc3[nH]c(c(CCC(=O)O)c3C)CC(=C1CCC(=O)O)CN2 |
|---|
| InChI Key | RXMFZONLFYHXCG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tetracarboxylic acids and derivatives |
|---|
| Direct Parent | tetracarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsdialkylaminesdihydropyridinesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganopnictogen compoundspyrroles |
|---|
| Substituents | secondary aliphatic aminecarbonyl groupcarboxylic acidazacycleamino acid or derivativesamino acidheteroaromatic compoundtetracarboxylic acid or derivativessecondary amineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compounddihydropyridineorganoheterocyclic compoundorganooxygen compoundamine |
|---|
