| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:41 UTC |
|---|
| Update Date | 2025-03-25 00:47:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02163988 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H7NO4S |
|---|
| Molecular Mass | 189.0096 |
|---|
| SMILES | CC1=CC(=CC=O)NS(=O)(=O)O1 |
|---|
| InChI Key | KPICRMSLVTYMFP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | organic sulfuric acids and derivatives |
|---|
| Direct Parent | organic sulfuric acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | aldehydesazacyclic compoundshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsvinylogous amides |
|---|
| Substituents | vinylogous amidecarbonyl grouporganic sulfuric acid or derivativesazacyclealdehydeoxacycleorganic oxideorganic oxygen compoundaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|
