| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:42 UTC |
|---|
| Update Date | 2025-03-25 00:47:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02164047 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H6O4S2 |
|---|
| Molecular Mass | 205.9708 |
|---|
| SMILES | CC1=C(C(=O)O)C(C(=O)O)SS1 |
|---|
| InChI Key | IAHYTIPMLGJUSU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | dicarboxylic acids and derivatives |
|---|
| Direct Parent | dicarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-dithiolescarbonyl compoundscarboxylic acidshydrocarbon derivativesorganic disulfidesorganic oxides |
|---|
| Substituents | 1,2-dithiolecarbonyl groupcarboxylic acidorganic oxideorganic oxygen compoundorganic disulfidealiphatic heteromonocyclic compounddithioledicarboxylic acid or derivativeshydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
