| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:47 UTC |
|---|
| Update Date | 2025-03-25 00:47:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02164216 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H13F2N5O2 |
|---|
| Molecular Mass | 261.1037 |
|---|
| SMILES | CC(O)C(F)(F)C1CNc2[nH]c(N)nc(=O)c2N1 |
|---|
| InChI Key | YDOAEGJVMVOIRE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesazacyclic compoundsfluorohydrinsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganofluoridesorganopnictogen compoundsprimary aminespyrimidonessecondary alcoholssecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | pyrimidonefluorohydrinorganohalogen compoundpyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundalkyl halidealcoholvinylogous amidepterinazacyclehalohydrinalkyl fluorideorganofluorideheteroaromatic compoundsecondary aminesecondary aliphatic/aromatic amineorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
