| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:49 UTC |
|---|
| Update Date | 2025-03-25 00:47:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02164302 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H19N5O2 |
|---|
| Molecular Mass | 301.1539 |
|---|
| SMILES | CC(O)C(O)C1CNc2c(Nc3ccccc3)ncnc2N1 |
|---|
| InChI Key | NKQFZCXOVSTJPI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | amines |
|---|
| Direct Parent | secondary alkylarylamines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganopnictogen compoundspyrimidines and pyrimidine derivativessecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietyazacycleheteroaromatic compoundsecondary aliphatic/aromatic aminepyrimidineorganic oxygen compoundaromatic heteropolycyclic compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativebenzenoidimidolactamorganoheterocyclic compoundorganooxygen compound1,2-diol |
|---|
