| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:51 UTC |
|---|
| Update Date | 2025-03-25 00:47:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02164380 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H10N2O6 |
|---|
| Molecular Mass | 254.0539 |
|---|
| SMILES | CC(N=CC=C1C=C(C(=O)O)NC(=O)O1)C(=O)O |
|---|
| InChI Key | WQZNBCLNYVTGSW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alanine and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | aldiminesalpha amino acidsazacyclic compoundscarbamate esterscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesenol estershydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundspropargyl-type 1,3-dipolar organic compounds |
|---|
| Substituents | carbonyl groupcarboxylic acidiminepropargyl-type 1,3-dipolar organic compoundaldimineorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundenol esterorganoheterocyclic compoundcarbonic acid derivativeazacyclecarbamic acid esterorganic 1,3-dipolar compoundoxacycleorganic oxygen compounddicarboxylic acid or derivativesalanine or derivativeshydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|