| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:53 UTC |
|---|
| Update Date | 2025-03-25 00:47:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02164460 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H7NO6 |
|---|
| Molecular Mass | 165.0273 |
|---|
| SMILES | CC(O)(CO[N+](=O)[O-])C(=O)O |
|---|
| InChI Key | WQOIEXBGIWRREH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | alpha hydroxy acids and derivatives |
|---|
| Direct Parent | alpha hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl nitratescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesnitrate estersorganic nitro compoundsorganic nitrogen compoundsorganic oxidestertiary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupcarboxylic acidorganic nitric acid or derivativesorganic nitratenitrate esteralpha-hydroxy acidallyl-type 1,3-dipolar organic compoundorganic 1,3-dipolar compoundcarboxylic acid derivativeorganic nitro compoundtertiary alcoholorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundalkyl nitratehydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundorganic hyponitrite |
|---|