| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:54 UTC |
|---|
| Update Date | 2025-03-25 00:47:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02164464 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H23NO8P+ |
|---|
| Molecular Mass | 316.1156 |
|---|
| SMILES | CC(O)(COP(=O)(O)OCC[N+](C)(C)C)C(O)C(=O)O |
|---|
| InChI Key | OFFQEJLLKZXLKI-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | quaternary ammonium salts |
|---|
| Direct Parent | phosphocholines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalpha hydroxy acids and derivativesaminescarbonyl compoundscarboxylic acidsdialkyl phosphatesfatty acids and conjugateshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundssecondary alcoholsshort-chain hydroxy acids and derivativestertiary alcoholstetraalkylammonium salts |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidalpha-hydroxy acidmonosaccharidefatty acidcarboxylic acid derivativesaccharideorganic oxideorganopnictogen compoundorganic cationorganic salt1,2-diolalcoholtetraalkylammonium salthydroxy acidphosphocholinedialkyl phosphatetertiary alcoholmonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estersecondary alcoholhydrocarbon derivativeorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
