| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:55 UTC |
|---|
| Update Date | 2025-03-25 00:47:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02164534 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H5F7O4S |
|---|
| Molecular Mass | 293.9797 |
|---|
| SMILES | CC(O)(C(F)(F)F)C(F)(F)C(F)(F)S(=O)(=O)O |
|---|
| InChI Key | YNIRLHFYNWWICJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfonic acids and derivatives |
|---|
| Subclass | organosulfonic acids and derivatives |
|---|
| Direct Parent | organosulfonic acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesfluorohydrinshydrocarbon derivativesorganic oxidesorganofluoridessulfonylstertiary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundhalohydrinalkyl fluorideorganofluorideorganosulfonic acidfluorohydrinorganosulfur compoundorganohalogen compoundtertiary alcoholorganic oxidesulfonylorganic oxygen compoundalkyl halidehydrocarbon derivativeorganooxygen compound |
|---|
