| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:55 UTC |
|---|
| Update Date | 2025-03-25 00:47:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02164540 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H15NO3 |
|---|
| Molecular Mass | 257.1052 |
|---|
| SMILES | CC(Nc1ccc(Oc2ccccc2)cc1)C(=O)O |
|---|
| InChI Key | PHUUCVZRQKYTDN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alanine and derivativesalpha amino acidsamino acidscarbonyl compoundscarboxylic acidsdiarylethershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsphenol ethersphenoxy compoundsphenylalkylaminessecondary alkylarylamines |
|---|
| Substituents | diaryl etherphenol ethercarbonyl groupethercarboxylic acidamino acid or derivativesamino acidalpha-amino acid or derivativescarboxylic acid derivativeorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundsecondary aminesecondary aliphatic/aromatic aminearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundphenylalkylaminealanine or derivativeshydrocarbon derivativeorganic nitrogen compoundphenoxy compounddiphenyletheramineorganooxygen compound |
|---|
