| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:56 UTC |
|---|
| Update Date | 2025-03-25 00:47:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02164581 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15NO |
|---|
| Molecular Mass | 165.1154 |
|---|
| SMILES | CC(c1ccccc1)[N+](C)(C)[O-] |
|---|
| InChI Key | SPXDTEABTLJWCR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganic oxidesorganic oxoanionic compoundsorganopnictogen compoundstrialkyl amine oxidestrisubstituted amine oxides and derivatives |
|---|
| Substituents | monocyclic benzene moietyn-oxidetrialkyl amine oxidearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundtrisubstituted n-oxideaminoxideorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic hyponitrite |
|---|
