Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:43:58 UTC |
---|
Update Date | 2025-03-25 00:47:52 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02164636 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C9H15NO8 |
---|
Molecular Mass | 265.0798 |
---|
SMILES | CC(OC1C(O)OC(C(=O)O)C(N)C1O)C(=O)O |
---|
InChI Key | HGZOKAUQOKILEH-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | glucuronic acid derivatives |
---|
Geometric Descriptor | aliphatic heteromonocyclic compounds |
---|
Alternative Parents | beta amino acids and derivativescarbonyl compoundscarboxylic acidsdialkyl ethersdicarboxylic acids and derivativeshemiacetalshydrocarbon derivativesmonoalkylaminesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespyran carboxylic acidssecondary alcohols |
---|
Substituents | carbonyl groupethercarboxylic acidglucuronic acid or derivativesmonosaccharidecarboxylic acid derivativepyran carboxylic aciddialkyl etherorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesbeta amino acid or derivativesoxacyclepyransecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeprimary aliphatic amineorganic nitrogen compound |
---|