| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:58 UTC |
|---|
| Update Date | 2025-03-25 00:47:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02164663 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C36H56O14 |
|---|
| Molecular Mass | 712.367 |
|---|
| SMILES | CC1(C)C2=CCC3C(CCC4C(C)(C)C(OC5OC(C(=O)O)C(O)C(O)C5O)CCC34C)C2(C)CCC1OC1OC(C(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | OMIPLLUQWXQWOX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesditerpene glycosidesditerpenoidsglucuronic acid derivativeshydrocarbon derivativeso-glucuronidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidglucuronic acid or derivativesabietane diterpenoido-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acidditerpene glycoside1-o-glucuronidealiphatic heteropolycyclic compoundbeta-hydroxy acidorganic oxideacetaloxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesterpene glycosidehydroxy acidoxacyclepyransecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativediterpenoid |
|---|