| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:43:59 UTC |
|---|
| Update Date | 2025-03-25 00:47:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02164704 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H34O4 |
|---|
| Molecular Mass | 362.2457 |
|---|
| SMILES | CC1(C)C(=O)CCC2(C)C3CCC4(C)C(CCC4(O)C(=O)O)C3CCC12 |
|---|
| InChI Key | JGLLAXYIRXIMML-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | androstane steroids |
|---|
| Direct Parent | androgens and derivatives |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | 17-hydroxysteroids3-oxosteroidsalpha hydroxy acids and derivativescarboxylic acidscyclic alcohols and derivativescyclic ketoneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidestertiary alcohols |
|---|
| Substituents | 20-hydroxysteroidcarbonyl groupcarboxylic acidandrogen-skeletonalpha-hydroxy acidcyclic ketonecarboxylic acid derivativealiphatic homopolycyclic compoundketoneorganic oxide17-hydroxysteroidalcoholoxosteroidhydroxysteroidhydroxy acidcyclic alcoholtertiary alcoholmonocarboxylic acid or derivativesorganic oxygen compound3-oxosteroidhydrocarbon derivativeorganooxygen compound |
|---|
