| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:01 UTC |
|---|
| Update Date | 2025-03-25 00:47:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02164748 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H15N3O3 |
|---|
| Molecular Mass | 213.1113 |
|---|
| SMILES | CC(O)C1NNC(=O)C2CCCN2C1=O |
|---|
| InChI Key | QWNIIMCICGPELR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | cyclic peptides |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acid hydrazidescarboxylic acids and derivativesdipeptideshydrocarbon derivativeslactamsorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrrolidinessecondary alcoholstertiary carboxylic acid amides |
|---|
| Substituents | alcoholcarboxylic acid hydrazidecarbonyl grouplactamazacyclealpha-amino acid or derivativescarboxamide groupaliphatic heteropolycyclic compoundalpha-dipeptideorganic oxideorganic oxygen compoundcyclic alpha peptidetertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundpyrrolidineorganoheterocyclic compoundorganooxygen compound |
|---|
