| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:06 UTC |
|---|
| Update Date | 2025-03-25 00:47:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02164964 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C28H48N2O24S |
|---|
| Molecular Mass | 828.2318 |
|---|
| SMILES | CC(=O)NC1C(O)OC(CO)C(O)C1OC1C(O)C(COS(=O)(=O)O)OC(OC2C(O)C(CO)OC(OC(C(O)CO)C(O)C(O)C=O)C2O)C1NC(C)=O |
|---|
| InChI Key | BSZMHCLGPWKZED-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | acylaminosugars |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidesalkyl glycosidesalkyl sulfatesalpha-hydroxyaldehydesbeta-hydroxy aldehydescarboxylic acids and derivativesdialkyl ethersfatty acyl glycosides of mono- and disaccharideshemiacetalshydrocarbon derivativesmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amidessulfuric acid monoesters |
|---|
| Substituents | fatty acylfatty acyl glycoside of mono- or disaccharidebeta-hydroxy aldehydesulfuric acid monoestercarbonyl groupethermonosaccharidecarboxylic acid derivativedialkyl ethern-acyl-alpha-hexosamineorganic oxidealpha-hydroxyaldehydeacetalalkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholorganic sulfuric acid or derivativesfatty acyl glycosidealdehydecarboxamide groupacylaminosugaroxacyclesecondary carboxylic acid amidesecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid esteralkyl glycoside |
|---|