| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:13 UTC |
|---|
| Update Date | 2025-03-25 00:47:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02165235 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H18O4 |
|---|
| Molecular Mass | 286.1205 |
|---|
| SMILES | CC1OC(c2ccc(O)cc2)C(c2ccc(O)cc2)C1O |
|---|
| InChI Key | SMDLVEGCUCTJIC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativesdialkyl ethershydrocarbon derivativesmonosaccharidesoxacyclic compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholmonocyclic benzene moietyetheraromatic heteromonocyclic compoundtetrahydrofuran1-hydroxy-2-unsubstituted benzenoidmonosaccharidedialkyl etheroxacyclesaccharideorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compoundstilbene |
|---|