| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:15 UTC |
|---|
| Update Date | 2025-03-25 00:47:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02165313 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C30H38O14 |
|---|
| Molecular Mass | 622.2262 |
|---|
| SMILES | CC1OC(OCC2OC(Oc3cc(CC4C(=O)OCC4Cc4cccc(O)c4)ccc3O)C(O)C(O)C2O)C(O)C(O)C1O |
|---|
| InChI Key | BSVSRSHQKJALOJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | lignan glycosides |
|---|
| Subclass | lignan glycosides |
|---|
| Direct Parent | lignan glycosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalscarbonyl compoundscarboxylic acid estersdibenzylbutyrolactone lignansgamma butyrolactoneshydrocarbon derivativeslignan lactonesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundlignan glycosidedibenzylbutyrolactone1-hydroxy-2-unsubstituted benzenoidmonosaccharidecarboxylic acid derivativelignan lactonelactonesaccharideorganic oxideacetal9,9p-epoxylignanoxaneorganoheterocyclic compoundalcoholtetrahydrofuran1-hydroxy-4-unsubstituted benzenoidgamma butyrolactoneoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterfuranoid lignansecondary alcoholphenolhydrocarbon derivativetetrahydrofuran lignanbenzenoidphenoxy compoundorganooxygen compound |
|---|