| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:25 UTC |
|---|
| Update Date | 2025-03-25 00:48:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02165682 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H18O9 |
|---|
| Molecular Mass | 354.0951 |
|---|
| SMILES | CC=Cc1ccc(OC2OC(C(=O)O)C(O)OC2C(=O)O)c(OC)c1 |
|---|
| InChI Key | XZLDWIXODCOKGU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenol ethers |
|---|
| Subclass | anisoles |
|---|
| Direct Parent | anisoles |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,4-dioxanesacetalsalkyl aryl ethersbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshemiacetalshydrocarbon derivativesmethoxybenzenesorganic oxidesoxacyclic compoundsphenoxy compounds |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupethercarboxylic acidaromatic heteromonocyclic compoundalkyl aryl ethercarboxylic acid derivativebeta-hydroxy acidorganic oxideacetalhemiacetalorganoheterocyclic compoundhydroxy acidmethoxybenzeneoxacycleorganic oxygen compoundanisolepara-dioxanedicarboxylic acid or derivativeshydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|
