| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:27 UTC |
|---|
| Update Date | 2025-03-25 00:48:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02165777 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H11NO2 |
|---|
| Molecular Mass | 189.079 |
|---|
| SMILES | CC1=NC(=O)C(C)(c2ccccc2)O1 |
|---|
| InChI Key | GZLYHOGLRNOMAI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesimidoestersn-acyliminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxazolinespropargyl-type 1,3-dipolar organic compounds |
|---|
| Substituents | n-acyliminemonocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundazacycleorganic 1,3-dipolar compoundcarboxylic acid derivativeimido esterpropargyl-type 1,3-dipolar organic compoundoxacycleoxazolineorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|
