| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:28 UTC |
|---|
| Update Date | 2025-03-25 00:48:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02165810 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H8O5 |
|---|
| Molecular Mass | 208.0372 |
|---|
| SMILES | CC1C(=O)Oc2cc(O)c(C(=O)O)cc21 |
|---|
| InChI Key | SRPGVXJJYSMORO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzofurans |
|---|
| Subclass | benzofuranones |
|---|
| Direct Parent | benzofuranones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoidsbenzenoidscarbonyl compoundscarboxylic acid esterscoumaransdicarboxylic acids and derivativeshydrocarbon derivativeslactonesorganic oxidesoxacyclic compoundssalicylic acid and derivativesvinylogous acids |
|---|
| Substituents | carbonyl groupcarboxylic acidbenzofuranone1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativehydroxybenzoic acidlactoneoxacyclevinylogous acidorganic oxideorganic oxygen compoundsalicylic acid or derivativesaromatic heteropolycyclic compoundcarboxylic acid esterdicarboxylic acid or derivativeshydrocarbon derivativebenzenoid1-carboxy-2-haloaromatic compoundcoumaranorganooxygen compound |
|---|
