| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:28 UTC |
|---|
| Update Date | 2025-03-25 00:48:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02165835 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H20O9 |
|---|
| Molecular Mass | 320.1107 |
|---|
| SMILES | CC1C=CC(C(=O)O)OC1OC(C(O)CO)C(O)C(O)C=O |
|---|
| InChI Key | HHJQZWMACWSZDS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyran carboxylic acids and derivatives |
|---|
| Direct Parent | pyran carboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsalpha-hydroxyaldehydesbeta-hydroxy aldehydescarboxylic acidsfatty alcoholshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsprimary alcoholssecondary alcohols |
|---|
| Substituents | fatty acylbeta-hydroxy aldehydecarbonyl groupcarboxylic acidmonosaccharidecarboxylic acid derivativesaccharideorganic oxidealpha-hydroxyaldehydeacetalfatty alcoholaliphatic heteromonocyclic compoundprimary alcoholalcoholpyran carboxylic acid or derivativesaldehydeoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|