Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:44:29 UTC |
---|
Update Date | 2025-03-25 00:48:04 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02165877 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C19H22O8 |
---|
Molecular Mass | 378.1315 |
---|
SMILES | CC1C(Oc2cccc(CC3OC(=O)C(=O)O3)c2)OC(C(=O)O)C(C)C1C |
---|
InChI Key | HOLSVJSYWOYAHB-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | pyrans |
---|
Subclass | pyran carboxylic acids and derivatives |
---|
Direct Parent | pyran carboxylic acids |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | 1,3-dioxolanesacetalscarbonyl compoundscarboxylic acid esterscarboxylic acidshydrocarbon derivativeslactonesorganic oxidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundstricarboxylic acids and derivatives |
---|
Substituents | phenol ethermonocyclic benzene moietymeta-dioxolanecarbonyl groupcarboxylic acidpyran carboxylic acid or derivativesaromatic heteromonocyclic compoundtricarboxylic acid or derivativescarboxylic acid derivativelactoneoxacycleorganic oxideorganic oxygen compoundacetalcarboxylic acid esterhydrocarbon derivativebenzenoidphenoxy compoundoxaneorganooxygen compound |
---|