| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:44:31 UTC |
|---|
| Update Date | 2025-03-25 00:48:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02165953 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H24O |
|---|
| Molecular Mass | 232.1827 |
|---|
| SMILES | CC1=CCCC(C)(C)C2=C1C(=O)CC(C)(C)C2 |
|---|
| InChI Key | OQIOQUNGZUUKEW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | sesquiterpenoids |
|---|
| Direct Parent | himachalane and lippifoliane sesquiterpenoids |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | cyclohexenoneshydrocarbon derivativesketonesorganic oxides |
|---|
| Substituents | ketonecyclohexenonecarbonyl grouporganic oxidehimachalane sesquiterpenoidorganic oxygen compoundhydrocarbon derivativeorganooxygen compoundaliphatic homopolycyclic compound |
|---|
